C18H20N7OP — CID 126546297
1-[2-[[1-(3-phosphanyl-2-pyridinyl)cyclobutyl]methylamino]pyrimidin-5-yl]pyrazole-4-carboxamide (PubChem CID 126546297) has the molecular formula C18H20N7OP and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-[2-[[1-(3-phosphanyl-2-pyridinyl)cyclobutyl]methylamino]pyrimidin-5-yl]pyrazole-4-carboxamide.
| Compound Name | 1-[2-[[1-(3-phosphanyl-2-pyridinyl)cyclobutyl]methylamino]pyrimidin-5-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 126546297 |
| Molecular Formula | C18H20N7OP |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[2-[[1-(3-phosphanyl-2-pyridinyl)cyclobutyl]methylamino]pyrimidin-5-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(-c2cnc(NCC3(c4ncccc4P)CCC3)nc2)c1 |
| InChI | InChI=1S/C18H20N7OP/c19-16(26)12-7-24-25(10-12)13-8-21-17(22-9-13)23-11-18(4-2-5-18)15-14(27)3-1-6-20-15/h1,3,6-10H,2,4-5,11,27H2,(H2,19,26)(H,21,22,23) |
| InChIKey | VQHNCICDJHENIX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|