C10H14N2O — CID 126546417
(3Z,5Z)-2,2-dimethyl-3-(methylamino)-7-oxohepta-3,5-dienenitrile (PubChem CID 126546417) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (3Z,5Z)-2,2-dimethyl-3-(methylamino)-7-oxohepta-3,5-dienenitrile.
| Compound Name | (3Z,5Z)-2,2-dimethyl-3-(methylamino)-7-oxohepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 126546417 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3Z,5Z)-2,2-dimethyl-3-(methylamino)-7-oxohepta-3,5-dienenitrile |
| SMILES | CN/C(=C\C=C/C=O)C(C)(C)C#N |
| InChI | InChI=1S/C10H14N2O/c1-10(2,8-11)9(12-3)6-4-5-7-13/h4-7,12H,1-3H3/b5-4-,9-6- |
| InChIKey | IPACBIQYPAKORO-WXOLFVLTSA-N |
| XLogP | 1.39 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|