About 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine
1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine (PubChem CID 126546676) has the molecular formula C15H19F3N2
and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine.
Molecular Properties
| Compound Name | 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine |
| PubChem CID | 126546676 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine |
| SMILES | C=C(N/N=C(\CCCCC)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H19F3N2/c1-3-4-6-11-14(15(16,17)18)20-19-12(2)13-9-7-5-8-10-13/h5,7-10,19H,2-4,6,11H2,1H3/b20-14+ |
| InChIKey | NLXGWMMZQPZENW-XSFVSMFZSA-N |
| XLogP | 4.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine?
The IUPAC name of 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine (CID 126546676) is 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine.
What is the SMILES notation for 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine?
The canonical SMILES for 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine is C=C(N/N=C(\CCCCC)C(F)(F)F)c1ccccc1.
What is the InChIKey of 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine?
The InChIKey is NLXGWMMZQPZENW-XSFVSMFZSA-N. The full InChI is InChI=1S/C15H19F3N2/c1-3-4-6-11-14(15(16,17)18)20-19-12(2)13-9-7-5-8-10-13/h5,7-10,19H,2-4,6,11H2,1H3/b20-14+.
What are the key properties of 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine?
1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine has a molecular weight of 284.33 g/mol, XLogP of 4.75, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-[(E)-1,1,1-trifluoroheptan-2-ylideneamino]ethenamine is sourced from PubChem (CID 126546676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).