C12H21NO5 — CID 126546746
(2S,4R,6S,7S,9R,10S)-4,10-dimethoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane (PubChem CID 126546746) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is (2S,4R,6S,7S,9R,10S)-4,10-dimethoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (2S,4R,6S,7S,9R,10S)-4,10-dimethoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 126546746 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2S,4R,6S,7S,9R,10S)-4,10-dimethoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane |
| SMILES | CO[C@H]1C[C@H]2[C@H](O[C@@H]3[C@@H](OC)OCCN32)[C@H](C)O1 |
| InChI | InChI=1S/C12H21NO5/c1-7-10-8(6-9(14-2)17-7)13-4-5-16-12(15-3)11(13)18-10/h7-12H,4-6H2,1-3H3/t7-,8-,9+,10+,11+,12-/m0/s1 |
| InChIKey | VPYABNNLIBBQEN-UFFGRJIKSA-N |
| XLogP | 0.17 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |