C22H26O6 — CID 126546858
prop-2-enyl (3aR,5R)-3a-[1-(4-ethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate (PubChem CID 126546858) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is prop-2-enyl (3aR,5R)-3a-[1-(4-ethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | prop-2-enyl (3aR,5R)-3a-[1-(4-ethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126546858 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | prop-2-enyl (3aR,5R)-3a-[1-(4-ethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C[C@]2(C(C)Cc3ccc(OCC)cc3)OCOC2=CC1=O |
| InChI | InChI=1S/C22H26O6/c1-4-10-26-21(24)18-13-22(20(12-19(18)23)27-14-28-22)15(3)11-16-6-8-17(9-7-16)25-5-2/h4,6-9,12,15,18H,1,5,10-11,13-14H2,2-3H3/t15?,18-,22-/m1/s1 |
| InChIKey | XIZIOLCWNQYVBH-HOQNBJKYSA-N |
| XLogP | 3.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|