C13H16N2O — CID 126547358
4,5-dimethyl-2-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyridazin-3-one (PubChem CID 126547358) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4,5-dimethyl-2-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyridazin-3-one.
| Compound Name | 4,5-dimethyl-2-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126547358 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4,5-dimethyl-2-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyridazin-3-one |
| SMILES | C=C/C(=C\C(=C)C)n1ncc(C)c(C)c1=O |
| InChI | InChI=1S/C13H16N2O/c1-6-12(7-9(2)3)15-13(16)11(5)10(4)8-14-15/h6-8H,1-2H2,3-5H3/b12-7+ |
| InChIKey | WZXLWJIQXPXREJ-KPKJPENVSA-N |
| XLogP | 2.46 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|