C14H18N2O — CID 126547638
4,5-dimethyl-2-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]pyridazin-3-one (PubChem CID 126547638) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 4,5-dimethyl-2-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]pyridazin-3-one.
| Compound Name | 4,5-dimethyl-2-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126547638 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 4,5-dimethyl-2-[(3E,5Z)-5-methylhepta-1,3,5-trien-3-yl]pyridazin-3-one |
| SMILES | C=C/C(=C\C(C)=C/C)n1ncc(C)c(C)c1=O |
| InChI | InChI=1S/C14H18N2O/c1-6-10(3)8-13(7-2)16-14(17)12(5)11(4)9-15-16/h6-9H,2H2,1,3-5H3/b10-6-,13-8+ |
| InChIKey | XZOXGNWRGGTBSA-QLRWNBFXSA-N |
| XLogP | 2.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|