C22H29N — CID 126547643
3,5-dimethyl-1-[4-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]phenyl]piperidine (PubChem CID 126547643) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 3,5-dimethyl-1-[4-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]phenyl]piperidine.
| Compound Name | 3,5-dimethyl-1-[4-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]phenyl]piperidine |
|---|---|
| PubChem CID | 126547643 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3,5-dimethyl-1-[4-[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]phenyl]piperidine |
| SMILES | C=C/C=C(\C=C/C)/C=C/c1ccc(N2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C22H29N/c1-5-7-20(8-6-2)9-10-21-11-13-22(14-12-21)23-16-18(3)15-19(4)17-23/h5-14,18-19H,1,15-17H2,2-4H3/b8-6-,10-9+,20-7+ |
| InChIKey | PHPJZBOSQZVVNT-IAPMEAJKSA-N |
| XLogP | 5.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|