C20H31N — CID 126547717
4,6-diethyl-3-ethynyl-5,8-dimethyl-7-methylideneundec-10-yn-2-imine (PubChem CID 126547717) has the molecular formula C20H31N and a molecular weight of 285.47 g/mol. Its IUPAC name is 4,6-diethyl-3-ethynyl-5,8-dimethyl-7-methylideneundec-10-yn-2-imine.
| Compound Name | 4,6-diethyl-3-ethynyl-5,8-dimethyl-7-methylideneundec-10-yn-2-imine |
|---|---|
| PubChem CID | 126547717 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 4,6-diethyl-3-ethynyl-5,8-dimethyl-7-methylideneundec-10-yn-2-imine |
| SMILES | [H]/N=C(\C)C(C#C)C(CC)C(C)C(CC)C(=C)C(C)CC#C |
| InChI | InChI=1S/C20H31N/c1-9-13-14(5)15(6)18(10-2)16(7)19(11-3)20(12-4)17(8)21/h1,4,14,16,18-21H,6,10-11,13H2,2-3,5,7-8H3/b21-17+ |
| InChIKey | JAGJZSGGDSLHNU-HEHNFIMWSA-N |
| XLogP | 5.18 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|