C33H43N3 — CID 126547909
9-(1-aminoethenyl)-5a,7,8,11-tetramethyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-12-methylidene-10-methylimino-3,5,6,6a,7,10a-hexahydro-2H-tetracen-1-amine (PubChem CID 126547909) has the molecular formula C33H43N3 and a molecular weight of 481.73 g/mol. Its IUPAC name is 9-(1-aminoethenyl)-5a,7,8,11-tetramethyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-12-methylidene-10-methylimino-3,5,6,6a,7,10a-hexahydro-2H-tetracen-1-amine.
| Compound Name | 9-(1-aminoethenyl)-5a,7,8,11-tetramethyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-12-methylidene-10-methylimino-3,5,6,6a,7,10a-hexahydro-2H-tetracen-1-amine |
|---|---|
| PubChem CID | 126547909 |
| Molecular Formula | C33H43N3 |
| Molecular Weight | 481.73 g/mol |
| Exact Mass | 481.35 |
| IUPAC Name | 9-(1-aminoethenyl)-5a,7,8,11-tetramethyl-4-(4-methylcyclohexa-1,3-dien-1-yl)-12-methylidene-10-methylimino-3,5,6,6a,7,10a-hexahydro-2H-tetracen-1-amine |
| SMILES | C=C(N)C1=C(C)C(C)C2CC3(C)CC4=C(C5=CC=C(C)CC5)CCC(N)=C4C(=C)C3=C(C)C2/C1=N/C |
| InChI | InChI=1S/C33H43N3/c1-17-9-11-23(12-10-17)24-13-14-27(35)29-20(4)31-21(5)30-25(15-33(31,7)16-26(24)29)18(2)19(3)28(22(6)34)32(30)36-8/h9,11,18,25,30H,4,6,10,12-16,34-35H2,1-3,5,7-8H3/b36-32+ |
| InChIKey | UUIXQVFACCDBAN-WIKZRCHHSA-N |
| XLogP | 7.38 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.73 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|