C15H17N — CID 126548720
(2E,3Z)-2-ethylidene-6-[(1Z,3Z)-penta-1,3-dienyl]-3-prop-2-enylidenepyridine (PubChem CID 126548720) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-6-[(1Z,3Z)-penta-1,3-dienyl]-3-prop-2-enylidenepyridine.
| Compound Name | (2E,3Z)-2-ethylidene-6-[(1Z,3Z)-penta-1,3-dienyl]-3-prop-2-enylidenepyridine |
|---|---|
| PubChem CID | 126548720 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2E,3Z)-2-ethylidene-6-[(1Z,3Z)-penta-1,3-dienyl]-3-prop-2-enylidenepyridine |
| SMILES | C=C/C=c1/ccc(/C=C\C=C/C)n/c1=C/C |
| InChI | InChI=1S/C15H17N/c1-4-7-8-10-14-12-11-13(9-5-2)15(6-3)16-14/h4-12H,2H2,1,3H3/b7-4-,10-8-,13-9-,15-6+ |
| InChIKey | XFWIMCVUTPDJOD-XGTNXRFBSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|