C11H14N2O — CID 126549350
N-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]prop-2-enamide (PubChem CID 126549350) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]prop-2-enamide.
| Compound Name | N-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126549350 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]prop-2-enamide |
| SMILES | C=C/C=C(N)\C(=C/C=C)NC(=O)C=C |
| InChI | InChI=1S/C11H14N2O/c1-4-7-9(12)10(8-5-2)13-11(14)6-3/h4-8H,1-3,12H2,(H,13,14)/b9-7+,10-8+ |
| InChIKey | AHUXXEXKXLCAKF-FIFLTTCUSA-N |
| XLogP | 1.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|