C13H28N2OS — CID 126549375
N-(2,2-dimethylpropyl)-2-(2,2-dimethylpropylsulfanyl)-2-(methylamino)acetamide (PubChem CID 126549375) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-(2,2-dimethylpropylsulfanyl)-2-(methylamino)acetamide.
| Compound Name | N-(2,2-dimethylpropyl)-2-(2,2-dimethylpropylsulfanyl)-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 126549375 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-(2,2-dimethylpropylsulfanyl)-2-(methylamino)acetamide |
| SMILES | CNC(SCC(C)(C)C)C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C13H28N2OS/c1-12(2,3)8-15-10(16)11(14-7)17-9-13(4,5)6/h11,14H,8-9H2,1-7H3,(H,15,16) |
| InChIKey | CVTAROBSONEHQI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|