C32H34Cl2N2O4 — CID 126549602
2-[2,4-dichloro-5-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid (PubChem CID 126549602) has the molecular formula C32H34Cl2N2O4 and a molecular weight of 581.54 g/mol. Its IUPAC name is 2-[2,4-dichloro-5-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2,4-dichloro-5-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126549602 |
| Molecular Formula | C32H34Cl2N2O4 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 2-[2,4-dichloro-5-[[2,3-dimethyl-5-[[(1S)-1-(3-propan-2-ylphenyl)ethyl]carbamoyl]indol-1-yl]methyl]phenoxy]propanoic acid |
| SMILES | Cc1c(C)n(Cc2cc(OC(C)C(=O)O)c(Cl)cc2Cl)c2ccc(C(=O)N[C@@H](C)c3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C32H34Cl2N2O4/c1-17(2)22-8-7-9-23(12-22)19(4)35-31(37)24-10-11-29-26(13-24)18(3)20(5)36(29)16-25-14-30(28(34)15-27(25)33)40-21(6)32(38)39/h7-15,17,19,21H,16H2,1-6H3,(H,35,37)(H,38,39)/t19-,21?/m0/s1 |
| InChIKey | YJOJAQFOUYYRRC-ZQRQZVKFSA-N |
| XLogP | 8.08 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|