C20H30O4 — CID 126549703
2-[(E,3R,7R)-5,7-dimethylnon-4-en-3-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 126549703) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[(E,3R,7R)-5,7-dimethylnon-4-en-3-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(E,3R,7R)-5,7-dimethylnon-4-en-3-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 126549703 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-[(E,3R,7R)-5,7-dimethylnon-4-en-3-yl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC[C@@H](C)C/C(C)=C/[C@@H](CC)C1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C20H30O4/c1-8-12(3)10-13(4)11-15(9-2)16-14(5)17(21)19(23-6)20(24-7)18(16)22/h11-12,15H,8-10H2,1-7H3/b13-11+/t12-,15-/m1/s1 |
| InChIKey | RMAIZLFWXSGLTB-LDGMUZPGSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|