About (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one
(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 12654976) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
Analyze (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The IUPAC name of (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (CID 12654976) is (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
What is the SMILES notation for (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The canonical SMILES for (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one is O=C1C[C@H]2CCC[C@H]2C1.
What is the InChIKey of (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
The InChIKey is ZOUYMLXOFDNVRK-KNVOCYPGSA-N. The full InChI is InChI=1S/C8H12O/c9-8-4-6-2-1-3-7(6)5-8/h6-7H,1-5H2/t6-,7+.
What are the key properties of (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one?
(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one has a molecular weight of 124.18 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one is sourced from PubChem (CID 12654976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).