C28H44O2 — CID 126549786
cis-(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,4-dimethylidenecyclohexane-1,3-diol (PubChem CID 126549786) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is cis-(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,4-dimethylidenecyclohexane-1,3-diol.
| Compound Name | cis-(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,4-dimethylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 126549786 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | cis-(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,4-dimethylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)[C@@H](C(C)CCCC(C)C)CC[C@@H]23)C[C@@H](O)C(=C)[C@@H]1O |
| InChI | InChI=1S/C28H44O2/c1-18(2)9-7-10-19(3)24-14-15-25-22(11-8-16-28(24,25)6)12-13-23-17-26(29)21(5)27(30)20(23)4/h12-13,18-19,24-27,29-30H,4-5,7-11,14-17H2,1-3,6H3/b22-12+,23-13-/t19?,24-,25+,26-,27-,28-/m1/s1 |
| InChIKey | SIZJSURQNFOXQM-PFWQWHOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|