C9H14O2 — CID 12654980
3,3a,4,5,6,7,8,8a-octahydrocyclohepta[b]furan-2-one (PubChem CID 12654980) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 3,3a,4,5,6,7,8,8a-octahydrocyclohepta[b]furan-2-one.
| Compound Name | 3,3a,4,5,6,7,8,8a-octahydrocyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 12654980 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3,3a,4,5,6,7,8,8a-octahydrocyclohepta[b]furan-2-one |
| SMILES | O=C1CC2CCCCCC2O1 |
| InChI | InChI=1S/C9H14O2/c10-9-6-7-4-2-1-3-5-8(7)11-9/h7-8H,1-6H2 |
| InChIKey | BLYGHAHUKQLNAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |