C18H12F6O7S — CID 126549857
3,3,3-trifluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 126549857) has the molecular formula C18H12F6O7S and a molecular weight of 486.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 126549857 |
| Molecular Formula | C18H12F6O7S |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 3,3,3-trifluoro-2-(6-prop-2-enoyloxynaphthalene-2-carbonyl)oxy-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | C=CC(=O)Oc1ccc2cc(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C18H12F6O7S/c1-2-14(25)30-13-6-5-10-7-12(4-3-11(10)8-13)15(26)31-16(17(19,20)21,18(22,23)24)9-32(27,28)29/h2-8H,1,9H2,(H,27,28,29) |
| InChIKey | VVTNQKDCGSWDLB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|