C18H25ClN5O5P — CID 126549958
9-[2-[[(3-chloro-4-methoxyphenyl)methoxy-methylphosphoryl]methoxy]ethyl]-6-methoxy-3,6-dihydropurin-2-amine (PubChem CID 126549958) has the molecular formula C18H25ClN5O5P and a molecular weight of 457.86 g/mol. Its IUPAC name is 9-[2-[[(3-chloro-4-methoxyphenyl)methoxy-methylphosphoryl]methoxy]ethyl]-6-methoxy-3,6-dihydropurin-2-amine.
| Compound Name | 9-[2-[[(3-chloro-4-methoxyphenyl)methoxy-methylphosphoryl]methoxy]ethyl]-6-methoxy-3,6-dihydropurin-2-amine |
|---|---|
| PubChem CID | 126549958 |
| Molecular Formula | C18H25ClN5O5P |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 9-[2-[[(3-chloro-4-methoxyphenyl)methoxy-methylphosphoryl]methoxy]ethyl]-6-methoxy-3,6-dihydropurin-2-amine |
| SMILES | COc1ccc(COP(C)(=O)COCCn2cnc3c2NC(N)=NC3OC)cc1Cl |
| InChI | InChI=1S/C18H25ClN5O5P/c1-26-14-5-4-12(8-13(14)19)9-29-30(3,25)11-28-7-6-24-10-21-15-16(24)22-18(20)23-17(15)27-2/h4-5,8,10,17H,6-7,9,11H2,1-3H3,(H3,20,22,23) |
| InChIKey | QYDVHFAAPNLAGD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|