C26H38O5 — CID 126550261
(1S,5S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4-dimethyl-9-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione (PubChem CID 126550261) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is (1S,5S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4-dimethyl-9-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione.
| Compound Name | (1S,5S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4-dimethyl-9-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
|---|---|
| PubChem CID | 126550261 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (1S,5S)-8-hydroxy-3-(2-hydroxypropan-2-yl)-4,4-dimethyl-9-(3-methylbutanoyl)-7-(3-methylbut-2-enyl)tricyclo[5.3.1.01,5]undec-8-ene-10,11-dione |
| SMILES | CC(C)=CCC12C[C@H]3C(C)(C)C(C(C)(C)O)C[C@@]3(C(=O)C(C(=O)CC(C)C)=C1O)C2=O |
| InChI | InChI=1S/C26H38O5/c1-14(2)9-10-25-12-18-23(5,6)17(24(7,8)31)13-26(18,22(25)30)21(29)19(20(25)28)16(27)11-15(3)4/h9,15,17-18,28,31H,10-13H2,1-8H3/t17?,18-,25?,26+/m0/s1 |
| InChIKey | RWAROQISUZNVLC-RIUCRCNJSA-N |
| XLogP | 4.73 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|