C22H25N3 — CID 126550804
2,4-bis(2,4-dimethylphenyl)-6-propan-2-yl-1,3,5-triazine (PubChem CID 126550804) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2,4-bis(2,4-dimethylphenyl)-6-propan-2-yl-1,3,5-triazine.
| Compound Name | 2,4-bis(2,4-dimethylphenyl)-6-propan-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 126550804 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2,4-bis(2,4-dimethylphenyl)-6-propan-2-yl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3C)nc(C(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C22H25N3/c1-13(2)20-23-21(18-9-7-14(3)11-16(18)5)25-22(24-20)19-10-8-15(4)12-17(19)6/h7-13H,1-6H3 |
| InChIKey | PXTFZVVXYGQIGZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |