C19H28F2N2O2 — CID 126551372
2,2-difluoro-1-[4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazin-1-yl]propan-1-one (PubChem CID 126551372) has the molecular formula C19H28F2N2O2 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2,2-difluoro-1-[4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazin-1-yl]propan-1-one.
| Compound Name | 2,2-difluoro-1-[4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 126551372 |
| Molecular Formula | C19H28F2N2O2 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2,2-difluoro-1-[4-[(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoyl]piperazin-1-yl]propan-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCN(C(=O)C(C)(F)F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H28F2N2O2/c1-14-6-5-9-18(2,3)15(14)7-8-16(24)22-10-12-23(13-11-22)17(25)19(4,20)21/h7-8H,5-6,9-13H2,1-4H3/b8-7+ |
| InChIKey | FLCCLGVFTJMEIM-BQYQJAHWSA-N |
| XLogP | 3.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|