C18H26F2N2O2 — CID 126551400
(E)-1-(4-acetylpiperazin-1-yl)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 126551400) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is (E)-1-(4-acetylpiperazin-1-yl)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-acetylpiperazin-1-yl)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126551400 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (E)-1-(4-acetylpiperazin-1-yl)-3-(3,3-difluoro-2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC(=O)N1CCN(C(=O)/C=C/C2=C(C)C(F)(F)CCC2(C)C)CC1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-13-15(17(3,4)7-8-18(13,19)20)5-6-16(24)22-11-9-21(10-12-22)14(2)23/h5-6H,7-12H2,1-4H3/b6-5+ |
| InChIKey | VCERABQHJHAOIH-AATRIKPKSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|