About 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide
4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide (PubChem CID 126551416) has the molecular formula C18H31N3O2
and a molecular weight of 321.47 g/mol. Its IUPAC name is 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide |
| PubChem CID | 126551416 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)N(C)CC2=C(C)CCCC2(C)C)CC1 |
| InChI | InChI=1S/C18H31N3O2/c1-14-7-6-8-18(3,4)16(14)13-19(5)17(23)21-11-9-20(10-12-21)15(2)22/h6-13H2,1-5H3 |
| InChIKey | JBZBIBHCSDJKSZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide?
The IUPAC name of 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide (CID 126551416) is 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide.
What is the SMILES notation for 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide?
The canonical SMILES for 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide is CC(=O)N1CCN(C(=O)N(C)CC2=C(C)CCCC2(C)C)CC1.
What is the InChIKey of 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide?
The InChIKey is JBZBIBHCSDJKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O2/c1-14-7-6-8-18(3,4)16(14)13-19(5)17(23)21-11-9-20(10-12-21)15(2)22/h6-13H2,1-5H3.
What are the key properties of 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide?
4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide has a molecular weight of 321.47 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-methyl-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1-carboxamide is sourced from PubChem (CID 126551416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).