C18H19FN2O4S2 — CID 126551539
methyl (3S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate (PubChem CID 126551539) has the molecular formula C18H19FN2O4S2 and a molecular weight of 410.49 g/mol. Its IUPAC name is methyl (3S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate.
| Compound Name | methyl (3S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate |
|---|---|
| PubChem CID | 126551539 |
| Molecular Formula | C18H19FN2O4S2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | methyl (3S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC23C(=O)N(C)C(C)(C(=O)N2C1c1ccc(F)cc1)S3=S |
| InChI | InChI=1S/C18H19FN2O4S2/c1-16(15(24)25-4)9-18-14(23)20(3)17(2,27(18)26)13(22)21(18)12(16)10-5-7-11(19)8-6-10/h5-8,12H,9H2,1-4H3/t12?,16-,17?,18?,27?/m0/s1 |
| InChIKey | PAUOLEUEXASJBW-ORIOHWEQSA-N |
| XLogP | 1.26 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |