C18H17N3O4S2 — CID 126551562
(3S)-4-(1,3-benzodioxol-4-yl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 126551562) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (3S)-4-(1,3-benzodioxol-4-yl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (3S)-4-(1,3-benzodioxol-4-yl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 126551562 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (3S)-4-(1,3-benzodioxol-4-yl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | CN1C(=O)C23C[C@](C)(C#N)C(c4cccc5c4OCO5)N2C(=O)C1(C)S3=S |
| InChI | InChI=1S/C18H17N3O4S2/c1-16(8-19)7-18-15(23)20(3)17(2,27(18)26)14(22)21(18)13(16)10-5-4-6-11-12(10)25-9-24-11/h4-6,13H,7,9H2,1-3H3/t13?,16-,17?,18?,27?/m1/s1 |
| InChIKey | FUFSKEZZTDTDGA-JDLJLXOSSA-N |
| XLogP | 1.20 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |