About (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium
(4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium (PubChem CID 126551608) has the molecular formula C15H16NO2S2+
and a molecular weight of 306.43 g/mol. Its IUPAC name is (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium.
Molecular Properties
| Compound Name | (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium |
| PubChem CID | 126551608 |
| Molecular Formula | C15H16NO2S2+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium |
| SMILES | CC[N+](CC)=c1sc2c(O)c3ccccc3c(O)c2s1 |
| InChI | InChI=1S/C15H15NO2S2/c1-3-16(4-2)15-19-13-11(17)9-7-5-6-8-10(9)12(18)14(13)20-15/h5-8H,3-4H2,1-2H3,(H-,17,18)/p+1 |
| InChIKey | GACBTAIBCTWDDF-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 43.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium?
The IUPAC name of (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium (CID 126551608) is (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium.
What is the SMILES notation for (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium?
The canonical SMILES for (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium is CC[N+](CC)=c1sc2c(O)c3ccccc3c(O)c2s1.
What is the InChIKey of (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium?
The InChIKey is GACBTAIBCTWDDF-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15NO2S2/c1-3-16(4-2)15-19-13-11(17)9-7-5-6-8-10(9)12(18)14(13)20-15/h5-8H,3-4H2,1-2H3,(H-,17,18)/p+1.
What are the key properties of (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium?
(4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium has a molecular weight of 306.43 g/mol, XLogP of 3.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,9-dihydroxybenzo[f][1,3]benzodithiol-2-ylidene)-diethylazanium is sourced from PubChem (CID 126551608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).