About 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine
5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 12655203) has the molecular formula C18H26N4O
and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine |
| PubChem CID | 12655203 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | COc1c(C(C)C)cc(Cc2cnc(N)nc2N)cc1C(C)C |
| InChI | InChI=1S/C18H26N4O/c1-10(2)14-7-12(8-15(11(3)4)16(14)23-5)6-13-9-21-18(20)22-17(13)19/h7-11H,6H2,1-5H3,(H4,19,20,21,22) |
| InChIKey | SMLJPKAFENVMOT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine (CID 12655203) is 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine is COc1c(C(C)C)cc(Cc2cnc(N)nc2N)cc1C(C)C.
What is the InChIKey of 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine?
The InChIKey is SMLJPKAFENVMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O/c1-10(2)14-7-12(8-15(11(3)4)16(14)23-5)6-13-9-21-18(20)22-17(13)19/h7-11H,6H2,1-5H3,(H4,19,20,21,22).
What are the key properties of 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine?
5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine has a molecular weight of 314.43 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-methoxy-3,5-di(propan-2-yl)phenyl]methyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 12655203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).