C14H22OS — CID 126552257
(3Z,5Z)-5-(3-propan-2-ylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol (PubChem CID 126552257) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is (3Z,5Z)-5-(3-propan-2-ylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol.
| Compound Name | (3Z,5Z)-5-(3-propan-2-ylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 126552257 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (3Z,5Z)-5-(3-propan-2-ylsulfanylpropyl)octa-1,3,5,7-tetraen-2-ol |
| SMILES | C=C/C=C(\C=C/C(=C)O)CCCSC(C)C |
| InChI | InChI=1S/C14H22OS/c1-5-7-14(10-9-13(4)15)8-6-11-16-12(2)3/h5,7,9-10,12,15H,1,4,6,8,11H2,2-3H3/b10-9-,14-7- |
| InChIKey | QXNQUHBYXYBSDP-BJAHLWDZSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|