C23H28O10S — CID 126552754
3-[5-oxo-2-[(3R)-4-oxoadamantane-1-carbonyl]oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 126552754) has the molecular formula C23H28O10S and a molecular weight of 496.53 g/mol. Its IUPAC name is 3-[5-oxo-2-[(3R)-4-oxoadamantane-1-carbonyl]oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 3-[5-oxo-2-[(3R)-4-oxoadamantane-1-carbonyl]oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 126552754 |
| Molecular Formula | C23H28O10S |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 3-[5-oxo-2-[(3R)-4-oxoadamantane-1-carbonyl]oxy-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | O=C1OC2C3CC(C2OC(=O)C24CC5CC(C2)C(=O)[C@H](C5)C4)C(C(=O)OCCCS(=O)(=O)O)C13 |
| InChI | InChI=1S/C23H28O10S/c24-17-11-4-10-5-12(17)9-23(7-10,8-11)22(27)33-19-13-6-14-16(21(26)32-18(14)19)15(13)20(25)31-2-1-3-34(28,29)30/h10-16,18-19H,1-9H2,(H,28,29,30)/t10?,11-,12?,13?,14?,15?,16?,18?,19?,23?/m1/s1 |
| InChIKey | PUOQEVNFIYPVMS-NVVSSOEQSA-N |
| XLogP | 0.92 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|