C17H18N6 — CID 12655286
2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 12655286) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 12655286 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(N)nc(Nc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C17H18N6/c1-11-3-7-13(8-4-11)19-16-21-15(18)22-17(23-16)20-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H4,18,19,20,21,22,23) |
| InChIKey | ZAOAABYOMVFNLJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |