About 5-fluoro-3,3-dimethyl-1H-2-benzofuran
5-fluoro-3,3-dimethyl-1H-2-benzofuran (PubChem CID 126553087) has the molecular formula C10H11FO
and a molecular weight of 166.19 g/mol. Its IUPAC name is 5-fluoro-3,3-dimethyl-1H-2-benzofuran.
Molecular Properties
| Compound Name | 5-fluoro-3,3-dimethyl-1H-2-benzofuran |
| PubChem CID | 126553087 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 5-fluoro-3,3-dimethyl-1H-2-benzofuran |
| SMILES | CC1(C)OCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H11FO/c1-10(2)9-5-8(11)4-3-7(9)6-12-10/h3-5H,6H2,1-2H3 |
| InChIKey | DOUFQJRFVZUVCU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-3,3-dimethyl-1H-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,3-dimethyl-1H-2-benzofuran?
The IUPAC name of 5-fluoro-3,3-dimethyl-1H-2-benzofuran (CID 126553087) is 5-fluoro-3,3-dimethyl-1H-2-benzofuran.
What is the SMILES notation for 5-fluoro-3,3-dimethyl-1H-2-benzofuran?
The canonical SMILES for 5-fluoro-3,3-dimethyl-1H-2-benzofuran is CC1(C)OCc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-3,3-dimethyl-1H-2-benzofuran?
The InChIKey is DOUFQJRFVZUVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO/c1-10(2)9-5-8(11)4-3-7(9)6-12-10/h3-5H,6H2,1-2H3.
What are the key properties of 5-fluoro-3,3-dimethyl-1H-2-benzofuran?
5-fluoro-3,3-dimethyl-1H-2-benzofuran has a molecular weight of 166.19 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,3-dimethyl-1H-2-benzofuran is sourced from PubChem (CID 126553087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).