C32H25N3O5 — CID 126554107
3-methyl-6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-10-azapentacyclo[16.3.1.02,10.04,9.012,17]docosa-1(21),2,4(9),5,7,12,14,16,18(22),19-decaene-21-carboxylic acid (PubChem CID 126554107) has the molecular formula C32H25N3O5 and a molecular weight of 531.57 g/mol. Its IUPAC name is 3-methyl-6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-10-azapentacyclo[16.3.1.02,10.04,9.012,17]docosa-1(21),2,4(9),5,7,12,14,16,18(22),19-decaene-21-carboxylic acid.
| Compound Name | 3-methyl-6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-10-azapentacyclo[16.3.1.02,10.04,9.012,17]docosa-1(21),2,4(9),5,7,12,14,16,18(22),19-decaene-21-carboxylic acid |
|---|---|
| PubChem CID | 126554107 |
| Molecular Formula | C32H25N3O5 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 3-methyl-6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-10-azapentacyclo[16.3.1.02,10.04,9.012,17]docosa-1(21),2,4(9),5,7,12,14,16,18(22),19-decaene-21-carboxylic acid |
| SMILES | Cc1c2n(c3ccc(C(=O)N[C@@H](C)c4ccc([N+](=O)[O-])cc4)cc13)Cc1ccccc1-c1ccc(C(=O)O)c-2c1 |
| InChI | InChI=1S/C32H25N3O5/c1-18-27-16-22(31(36)33-19(2)20-7-11-24(12-8-20)35(39)40)10-14-29(27)34-17-23-5-3-4-6-25(23)21-9-13-26(32(37)38)28(15-21)30(18)34/h3-16,19H,17H2,1-2H3,(H,33,36)(H,37,38)/t19-/m0/s1 |
| InChIKey | ZRRHEMBDPYGOJY-IBGZPJMESA-N |
| XLogP | 6.74 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|