C22H17IN2O — CID 1265552
(12R)-12-(2-iodophenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one (PubChem CID 1265552) has the molecular formula C22H17IN2O and a molecular weight of 452.30 g/mol. Its IUPAC name is (12R)-12-(2-iodophenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one.
| Compound Name | (12R)-12-(2-iodophenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 1265552 |
| Molecular Formula | C22H17IN2O |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | (12R)-12-(2-iodophenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
| SMILES | O=C1CCCC2=C1[C@H](c1ccccc1I)c1c(ccc3ncccc13)N2 |
| InChI | InChI=1S/C22H17IN2O/c23-15-7-2-1-5-13(15)21-20-14-6-4-12-24-16(14)10-11-18(20)25-17-8-3-9-19(26)22(17)21/h1-2,4-7,10-12,21,25H,3,8-9H2/t21-/m1/s1 |
| InChIKey | KAUQWZKYRUUTHE-OAQYLSRUSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|