C21H22F3N5OS — CID 126555527
N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 126555527) has the molecular formula C21H22F3N5OS and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555527 |
| Molecular Formula | C21H22F3N5OS |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | Cc1cnc2c(c1)OCC/C2=N/NC(=S)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H22F3N5OS/c1-14-11-18-19(25-13-14)17(5-10-30-18)26-27-20(31)29-8-6-28(7-9-29)16-4-2-3-15(12-16)21(22,23)24/h2-4,11-13H,5-10H2,1H3,(H,27,31)/b26-17- |
| InChIKey | ZCMOTMVTZAGKBM-ONUIUJJFSA-N |
| XLogP | 3.59 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|