C16H22FN5OS — CID 126555537
4-(2-fluoroethyl)-N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555537) has the molecular formula C16H22FN5OS and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-(2-fluoroethyl)-N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555537 |
| Molecular Formula | C16H22FN5OS |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-(2-fluoroethyl)-N-[(Z)-(7-methyl-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | Cc1cnc2c(c1)OCC/C2=N/NC(=S)N1CCN(CCF)CC1 |
| InChI | InChI=1S/C16H22FN5OS/c1-12-10-14-15(18-11-12)13(2-9-23-14)19-20-16(24)22-7-5-21(4-3-17)6-8-22/h10-11H,2-9H2,1H3,(H,20,24)/b19-13- |
| InChIKey | LUSXJKHMBIZTEK-UYRXBGFRSA-N |
| XLogP | 1.34 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|