C17H26N6OS — CID 126555602
N-ethyl-2-[[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]carbamothioyl-propylamino]acetamide (PubChem CID 126555602) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is N-ethyl-2-[[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]carbamothioyl-propylamino]acetamide.
| Compound Name | N-ethyl-2-[[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]carbamothioyl-propylamino]acetamide |
|---|---|
| PubChem CID | 126555602 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-ethyl-2-[[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]carbamothioyl-propylamino]acetamide |
| SMILES | CCCN(CC(=O)NCC)C(=S)N/N=C1/CCN(C)c2cccnc21 |
| InChI | InChI=1S/C17H26N6OS/c1-4-10-23(12-15(24)18-5-2)17(25)21-20-13-8-11-22(3)14-7-6-9-19-16(13)14/h6-7,9H,4-5,8,10-12H2,1-3H3,(H,18,24)(H,21,25)/b20-13- |
| InChIKey | AKWSWCNJAHGBOI-MOSHPQCFSA-N |
| XLogP | 1.35 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|