C17H24N6OS — CID 126555664
(3S,5R)-N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide (PubChem CID 126555664) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is (3S,5R)-N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide.
| Compound Name | (3S,5R)-N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555664 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (3S,5R)-N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-3,5-dimethylpiperazine-1-carbothioamide |
| SMILES | CC(=O)N1CC/C(=N/NC(=S)N2C[C@@H](C)N[C@@H](C)C2)c2ncccc21 |
| InChI | InChI=1S/C17H24N6OS/c1-11-9-22(10-12(2)19-11)17(25)21-20-14-6-8-23(13(3)24)15-5-4-7-18-16(14)15/h4-5,7,11-12,19H,6,8-10H2,1-3H3,(H,21,25)/b20-14-/t11-,12+ |
| InChIKey | ZZOJUFBGAAHRDT-HZFZNETPSA-N |
| XLogP | 1.10 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|