C14H18FN5OS — CID 126555678
N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-methylpiperazine-1-carbothioamide (PubChem CID 126555678) has the molecular formula C14H18FN5OS and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-methylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555678 |
| Molecular Formula | C14H18FN5OS |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-methylpiperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)N/N=C2/CCOc3c(F)ccnc32)CC1 |
| InChI | InChI=1S/C14H18FN5OS/c1-19-5-7-20(8-6-19)14(22)18-17-11-3-9-21-13-10(15)2-4-16-12(11)13/h2,4H,3,5-9H2,1H3,(H,18,22)/b17-11- |
| InChIKey | PPFQRKLZASXFJG-BOPFTXTBSA-N |
| XLogP | 0.83 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|