About [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea
[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea (PubChem CID 126555679) has the molecular formula C9H9FN4OS
and a molecular weight of 240.26 g/mol. Its IUPAC name is [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea |
| PubChem CID | 126555679 |
| Molecular Formula | C9H9FN4OS |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea |
| SMILES | NC(=S)N/N=C1/CCOc2c(F)ccnc21 |
| InChI | InChI=1S/C9H9FN4OS/c10-5-1-3-12-7-6(13-14-9(11)16)2-4-15-8(5)7/h1,3H,2,4H2,(H3,11,14,16)/b13-6- |
| InChIKey | SCVDHACBJWWZST-MLPAPPSSSA-N |
| XLogP | 0.54 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea?
The IUPAC name of [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea (CID 126555679) is [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea.
What is the SMILES notation for [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea?
The canonical SMILES for [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea is NC(=S)N/N=C1/CCOc2c(F)ccnc21.
What is the InChIKey of [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea?
The InChIKey is SCVDHACBJWWZST-MLPAPPSSSA-N. The full InChI is InChI=1S/C9H9FN4OS/c10-5-1-3-12-7-6(13-14-9(11)16)2-4-15-8(5)7/h1,3H,2,4H2,(H3,11,14,16)/b13-6-.
What are the key properties of [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea?
[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea has a molecular weight of 240.26 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]thiourea is sourced from PubChem (CID 126555679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).