C15H20FN5OS — CID 126555681
4-ethyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555681) has the molecular formula C15H20FN5OS and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-ethyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-ethyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555681 |
| Molecular Formula | C15H20FN5OS |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-ethyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | CCN1CCN(C(=S)N/N=C2/CCOc3c(F)ccnc32)CC1 |
| InChI | InChI=1S/C15H20FN5OS/c1-2-20-6-8-21(9-7-20)15(23)19-18-12-4-10-22-14-11(16)3-5-17-13(12)14/h3,5H,2,4,6-10H2,1H3,(H,19,23)/b18-12- |
| InChIKey | NSMAJHXGSAKMOF-PDGQHHTCSA-N |
| XLogP | 1.22 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|