C15H19F2N5OS — CID 126555810
N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(2-fluoroethyl)piperazine-1-carbothioamide (PubChem CID 126555810) has the molecular formula C15H19F2N5OS and a molecular weight of 355.41 g/mol. Its IUPAC name is N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(2-fluoroethyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(2-fluoroethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555810 |
| Molecular Formula | C15H19F2N5OS |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(2-fluoroethyl)piperazine-1-carbothioamide |
| SMILES | FCCN1CCN(C(=S)N/N=C2/CCOc3c(F)ccnc32)CC1 |
| InChI | InChI=1S/C15H19F2N5OS/c16-3-5-21-6-8-22(9-7-21)15(24)20-19-12-2-10-23-14-11(17)1-4-18-13(12)14/h1,4H,2-3,5-10H2,(H,20,24)/b19-12- |
| InChIKey | VSYVRDLYTGDMJR-UNOMPAQXSA-N |
| XLogP | 1.17 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|