C19H21FN6OS — CID 126555811
4-(4-aminophenyl)-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555811) has the molecular formula C19H21FN6OS and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-(4-aminophenyl)-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555811 |
| Molecular Formula | C19H21FN6OS |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-(4-aminophenyl)-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | Nc1ccc(N2CCN(C(=S)N/N=C3/CCOc4c(F)ccnc43)CC2)cc1 |
| InChI | InChI=1S/C19H21FN6OS/c20-15-5-7-22-17-16(6-12-27-18(15)17)23-24-19(28)26-10-8-25(9-11-26)14-3-1-13(21)2-4-14/h1-5,7H,6,8-12,21H2,(H,24,28)/b23-16- |
| InChIKey | FXJSOVLWARDRDQ-KQWNVCNZSA-N |
| XLogP | 1.99 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|