C21H24FN7OS — CID 126555882
N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-amino-2-fluorophenyl)piperazine-1-carbothioamide (PubChem CID 126555882) has the molecular formula C21H24FN7OS and a molecular weight of 441.54 g/mol. Its IUPAC name is N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-amino-2-fluorophenyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-amino-2-fluorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555882 |
| Molecular Formula | C21H24FN7OS |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-amino-2-fluorophenyl)piperazine-1-carbothioamide |
| SMILES | CC(=O)N1CC/C(=N/NC(=S)N2CCN(c3ccc(N)cc3F)CC2)c2ncccc21 |
| InChI | InChI=1S/C21H24FN7OS/c1-14(30)29-8-6-17(20-19(29)3-2-7-24-20)25-26-21(31)28-11-9-27(10-12-28)18-5-4-15(23)13-16(18)22/h2-5,7,13H,6,8-12,23H2,1H3,(H,26,31)/b25-17- |
| InChIKey | CAAKYTBIFNGQMH-UQQQWYQISA-N |
| XLogP | 1.96 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|