C15H10N2O3 — CID 12655636
3,6-diphenyl-1,3,5-oxadiazine-2,4-dione (PubChem CID 12655636) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3,6-diphenyl-1,3,5-oxadiazine-2,4-dione.
| Compound Name | 3,6-diphenyl-1,3,5-oxadiazine-2,4-dione |
|---|---|
| PubChem CID | 12655636 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3,6-diphenyl-1,3,5-oxadiazine-2,4-dione |
| SMILES | O=c1nc(-c2ccccc2)oc(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C15H10N2O3/c18-14-16-13(11-7-3-1-4-8-11)20-15(19)17(14)12-9-5-2-6-10-12/h1-10H |
| InChIKey | OBUXWJXLQCGJNE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |