About ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate
ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate (PubChem CID 126556415) has the molecular formula C19H24F3NO4
and a molecular weight of 387.40 g/mol. Its IUPAC name is ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate |
| PubChem CID | 126556415 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate |
| SMILES | C=Cc1c(C(F)(F)F)cc(C(=O)OC(C)(C)C)c(C(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C19H24F3NO4/c1-8-10-12(19(20,21)22)9-11(15(24)26-17(2,3)4)13(14(10)23)16(25)27-18(5,6)7/h8-9H,1,23H2,2-7H3 |
| InChIKey | TWRRYVGVVDIJBQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate?
The IUPAC name of ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate (CID 126556415) is ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate.
What is the SMILES notation for ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate?
The canonical SMILES for ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate is C=Cc1c(C(F)(F)F)cc(C(=O)OC(C)(C)C)c(C(=O)OC(C)(C)C)c1N.
What is the InChIKey of ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate?
The InChIKey is TWRRYVGVVDIJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F3NO4/c1-8-10-12(19(20,21)22)9-11(15(24)26-17(2,3)4)13(14(10)23)16(25)27-18(5,6)7/h8-9H,1,23H2,2-7H3.
What are the key properties of ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate?
ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate has a molecular weight of 387.40 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 3-amino-4-ethenyl-5-(trifluoromethyl)benzene-1,2-dicarboxylate is sourced from PubChem (CID 126556415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).