C9H13N — CID 12655650
(1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 12655650) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 12655650 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (1R,2S,6R,7S)-4-azatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C9H13N/c1-2-7-3-6(1)8-4-10-5-9(7)8/h1-2,6-10H,3-5H2/t6-,7+,8-,9+ |
| InChIKey | CJMPQJDYEONFGO-SPJNRGJMSA-N |
| XLogP | 1.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|