About 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine
2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine (PubChem CID 126556965) has the molecular formula C8H9F3N2O
and a molecular weight of 206.17 g/mol. Its IUPAC name is 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine.
Molecular Properties
| Compound Name | 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine |
| PubChem CID | 126556965 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine |
| SMILES | Cc1cnc(OC(C)C(F)(F)F)cn1 |
| InChI | InChI=1S/C8H9F3N2O/c1-5-3-13-7(4-12-5)14-6(2)8(9,10)11/h3-4,6H,1-2H3 |
| InChIKey | XDZPTISRIVAILI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine?
The IUPAC name of 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine (CID 126556965) is 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine.
What is the SMILES notation for 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine?
The canonical SMILES for 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine is Cc1cnc(OC(C)C(F)(F)F)cn1.
What is the InChIKey of 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine?
The InChIKey is XDZPTISRIVAILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O/c1-5-3-13-7(4-12-5)14-6(2)8(9,10)11/h3-4,6H,1-2H3.
What are the key properties of 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine?
2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine has a molecular weight of 206.17 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazine is sourced from PubChem (CID 126556965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).