About [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol
[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol (PubChem CID 126557145) has the molecular formula C10H18F2N2O
and a molecular weight of 220.26 g/mol. Its IUPAC name is [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol |
| PubChem CID | 126557145 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CC(F)(F)CN1C1CCNCC1 |
| InChI | InChI=1S/C10H18F2N2O/c11-10(12)5-9(6-15)14(7-10)8-1-3-13-4-2-8/h8-9,13,15H,1-7H2/t9-/m1/s1 |
| InChIKey | PQDDYMGDTKOVRF-SECBINFHSA-N |
| XLogP | 0.44 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol (CID 126557145) is [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol is OC[C@H]1CC(F)(F)CN1C1CCNCC1.
What is the InChIKey of [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol?
The InChIKey is PQDDYMGDTKOVRF-SECBINFHSA-N. The full InChI is InChI=1S/C10H18F2N2O/c11-10(12)5-9(6-15)14(7-10)8-1-3-13-4-2-8/h8-9,13,15H,1-7H2/t9-/m1/s1.
What are the key properties of [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol?
[(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol has a molecular weight of 220.26 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4,4-difluoro-1-piperidin-4-ylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 126557145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).